C16H17F3N2OS — CID 174564581
[4-(5-iminopentyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methanol (PubChem CID 174564581) has the molecular formula C16H17F3N2OS and a molecular weight of 342.39 g/mol. Its IUPAC name is [4-(5-iminopentyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methanol.
| Compound Name | [4-(5-iminopentyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 174564581 |
| Molecular Formula | C16H17F3N2OS |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [4-(5-iminopentyl)-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]methanol |
| SMILES | [H]/N=C/CCCCc1nc(-c2ccc(C(F)(F)F)cc2)sc1CO |
| InChI | InChI=1S/C16H17F3N2OS/c17-16(18,19)12-7-5-11(6-8-12)15-21-13(14(10-22)23-15)4-2-1-3-9-20/h5-9,20,22H,1-4,10H2/b20-9+ |
| InChIKey | ZUTGKWANSSURPX-AWQFTUOYSA-N |
| XLogP | 4.68 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|