C21H20F3NO3S2 — CID 58934100
2-[5-ethyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 58934100) has the molecular formula C21H20F3NO3S2 and a molecular weight of 455.52 g/mol. Its IUPAC name is 2-[5-ethyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[5-ethyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58934100 |
| Molecular Formula | C21H20F3NO3S2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 2-[5-ethyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | CCc1sc(-c2ccc(C(F)(F)F)cc2)nc1CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H20F3NO3S2/c1-3-19-18(12-13-28-30(26,27)17-10-4-14(2)5-11-17)25-20(29-19)15-6-8-16(9-7-15)21(22,23)24/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | UYRWKXLXYZOCMD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|