C26H24F3NO3S — CID 175599000
2-[6-[2-[4-(trifluoromethyl)phenyl]ethyl]indol-1-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 175599000) has the molecular formula C26H24F3NO3S and a molecular weight of 487.54 g/mol. Its IUPAC name is 2-[6-[2-[4-(trifluoromethyl)phenyl]ethyl]indol-1-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[6-[2-[4-(trifluoromethyl)phenyl]ethyl]indol-1-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175599000 |
| Molecular Formula | C26H24F3NO3S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 2-[6-[2-[4-(trifluoromethyl)phenyl]ethyl]indol-1-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCn2ccc3ccc(CCc4ccc(C(F)(F)F)cc4)cc32)cc1 |
| InChI | InChI=1S/C26H24F3NO3S/c1-19-2-12-24(13-3-19)34(31,32)33-17-16-30-15-14-22-9-6-21(18-25(22)30)5-4-20-7-10-23(11-8-20)26(27,28)29/h2-3,6-15,18H,4-5,16-17H2,1H3 |
| InChIKey | IRCVWMGITXLTHE-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|