C19H18ClNO3S — CID 159858263
2-(3-chloro-4-pyrrol-1-ylphenyl)ethyl 4-methylbenzenesulfonate (PubChem CID 159858263) has the molecular formula C19H18ClNO3S and a molecular weight of 375.88 g/mol. Its IUPAC name is 2-(3-chloro-4-pyrrol-1-ylphenyl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(3-chloro-4-pyrrol-1-ylphenyl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 159858263 |
| Molecular Formula | C19H18ClNO3S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2-(3-chloro-4-pyrrol-1-ylphenyl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2ccc(-n3cccc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H18ClNO3S/c1-15-4-7-17(8-5-15)25(22,23)24-13-10-16-6-9-19(18(20)14-16)21-11-2-3-12-21/h2-9,11-12,14H,10,13H2,1H3 |
| InChIKey | NQURGBPCVAILMK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|