C18H18O4S — CID 59318303
2-(3-oxo-1,2-dihydroinden-5-yl)ethyl 4-methylbenzenesulfonate (PubChem CID 59318303) has the molecular formula C18H18O4S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-(3-oxo-1,2-dihydroinden-5-yl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(3-oxo-1,2-dihydroinden-5-yl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59318303 |
| Molecular Formula | C18H18O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-(3-oxo-1,2-dihydroinden-5-yl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2ccc3c(c2)C(=O)CC3)cc1 |
| InChI | InChI=1S/C18H18O4S/c1-13-2-7-16(8-3-13)23(20,21)22-11-10-14-4-5-15-6-9-18(19)17(15)12-14/h2-5,7-8,12H,6,9-11H2,1H3 |
| InChIKey | CGMCLVZDHQWRCF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|