C26H29N5O4S — CID 132514496
2-[6-[5-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-oxadiazol-2-yl]indol-1-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 132514496) has the molecular formula C26H29N5O4S and a molecular weight of 507.62 g/mol. Its IUPAC name is 2-[6-[5-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-oxadiazol-2-yl]indol-1-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[6-[5-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-oxadiazol-2-yl]indol-1-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 132514496 |
| Molecular Formula | C26H29N5O4S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-[6-[5-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-oxadiazol-2-yl]indol-1-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCn2ccc3ccc(-c4nnc(N5CCN6CCC5CC6)o4)cc32)cc1 |
| InChI | InChI=1S/C26H29N5O4S/c1-19-2-6-23(7-3-19)36(32,33)34-17-16-30-13-8-20-4-5-21(18-24(20)30)25-27-28-26(35-25)31-15-14-29-11-9-22(31)10-12-29/h2-8,13,18,22H,9-12,14-17H2,1H3 |
| InChIKey | WGKGLNZSAXXPOP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 93.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|