C19H20N2O6S — CID 22326628
2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)ethyl 4-methylbenzenesulfonate (PubChem CID 22326628) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22326628 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-(6,7-dimethoxy-4-oxoquinazolin-3-yl)ethyl 4-methylbenzenesulfonate |
| SMILES | COc1cc2ncn(CCOS(=O)(=O)c3ccc(C)cc3)c(=O)c2cc1OC |
| InChI | InChI=1S/C19H20N2O6S/c1-13-4-6-14(7-5-13)28(23,24)27-9-8-21-12-20-16-11-18(26-3)17(25-2)10-15(16)19(21)22/h4-7,10-12H,8-9H2,1-3H3 |
| InChIKey | QDLNRFHZEACEFG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|