C24H29N3O5S — CID 4069677
N-butyl-2-[6,7-dimethoxy-3-[(4-methoxyphenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 4069677) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is N-butyl-2-[6,7-dimethoxy-3-[(4-methoxyphenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-butyl-2-[6,7-dimethoxy-3-[(4-methoxyphenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4069677 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-butyl-2-[6,7-dimethoxy-3-[(4-methoxyphenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | CCCCNC(=O)CSc1nc2cc(OC)c(OC)cc2c(=O)n1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H29N3O5S/c1-5-6-11-25-22(28)15-33-24-26-19-13-21(32-4)20(31-3)12-18(19)23(29)27(24)14-16-7-9-17(30-2)10-8-16/h7-10,12-13H,5-6,11,14-15H2,1-4H3,(H,25,28) |
| InChIKey | ZGCMJYFQRROZSY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|