C26H29NO4 — CID 174566113
(E)-4-[2-(3,4-diethoxyphenyl)-1,3-oxazol-4-yl]-2-(2-propan-2-ylphenyl)but-2-enal (PubChem CID 174566113) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is (E)-4-[2-(3,4-diethoxyphenyl)-1,3-oxazol-4-yl]-2-(2-propan-2-ylphenyl)but-2-enal.
| Compound Name | (E)-4-[2-(3,4-diethoxyphenyl)-1,3-oxazol-4-yl]-2-(2-propan-2-ylphenyl)but-2-enal |
|---|---|
| PubChem CID | 174566113 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (E)-4-[2-(3,4-diethoxyphenyl)-1,3-oxazol-4-yl]-2-(2-propan-2-ylphenyl)but-2-enal |
| SMILES | CCOc1ccc(-c2nc(C/C=C(/C=O)c3ccccc3C(C)C)co2)cc1OCC |
| InChI | InChI=1S/C26H29NO4/c1-5-29-24-14-12-19(15-25(24)30-6-2)26-27-21(17-31-26)13-11-20(16-28)23-10-8-7-9-22(23)18(3)4/h7-12,14-18H,5-6,13H2,1-4H3/b20-11- |
| InChIKey | QFJUMWBARVDWQB-JAIQZWGSSA-N |
| XLogP | 6.09 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|