About 3-aminononyl 2,2,2-trifluoroacetate
3-aminononyl 2,2,2-trifluoroacetate (PubChem CID 174567455) has the molecular formula C11H20F3NO2
and a molecular weight of 255.28 g/mol. Its IUPAC name is 3-aminononyl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 3-aminononyl 2,2,2-trifluoroacetate |
| PubChem CID | 174567455 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-aminononyl 2,2,2-trifluoroacetate |
| SMILES | CCCCCCC(N)CCOC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H20F3NO2/c1-2-3-4-5-6-9(15)7-8-17-10(16)11(12,13)14/h9H,2-8,15H2,1H3 |
| InChIKey | SDSQVYWJIGTUEQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-aminononyl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminononyl 2,2,2-trifluoroacetate?
The IUPAC name of 3-aminononyl 2,2,2-trifluoroacetate (CID 174567455) is 3-aminononyl 2,2,2-trifluoroacetate.
What is the SMILES notation for 3-aminononyl 2,2,2-trifluoroacetate?
The canonical SMILES for 3-aminononyl 2,2,2-trifluoroacetate is CCCCCCC(N)CCOC(=O)C(F)(F)F.
What is the InChIKey of 3-aminononyl 2,2,2-trifluoroacetate?
The InChIKey is SDSQVYWJIGTUEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3NO2/c1-2-3-4-5-6-9(15)7-8-17-10(16)11(12,13)14/h9H,2-8,15H2,1H3.
What are the key properties of 3-aminononyl 2,2,2-trifluoroacetate?
3-aminononyl 2,2,2-trifluoroacetate has a molecular weight of 255.28 g/mol, XLogP of 2.78, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminononyl 2,2,2-trifluoroacetate is sourced from PubChem (CID 174567455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).