About 1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid
1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174568376) has the molecular formula C20H17NO8S
and a molecular weight of 431.42 g/mol. Its IUPAC name is 1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid |
| PubChem CID | 174568376 |
| Molecular Formula | C20H17NO8S |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(C(=O)O)cccc1C(=O)O.O=C(O)c1ccn(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C11H9NO4S.C9H8O4/c13-11(14)9-6-7-12(8-9)17(15,16)10-4-2-1-3-5-10;1-5-6(8(10)11)3-2-4-7(5)9(12)13/h1-8H,(H,13,14);2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | NFYCOHQYRGYEGS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 150.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid (CID 174568376) is 1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid is Cc1c(C(=O)O)cccc1C(=O)O.O=C(O)c1ccn(S(=O)(=O)c2ccccc2)c1.
What is the InChIKey of 1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid?
The InChIKey is NFYCOHQYRGYEGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO4S.C9H8O4/c13-11(14)9-6-7-12(8-9)17(15,16)10-4-2-1-3-5-10;1-5-6(8(10)11)3-2-4-7(5)9(12)13/h1-8H,(H,13,14);2-4H,1H3,(H,10,11)(H,12,13).
What are the key properties of 1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid?
1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid has a molecular weight of 431.42 g/mol, XLogP of 2.81, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)pyrrole-3-carboxylic acid;2-methylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 174568376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).