C20H19NO4S — CID 51359206
ethyl 1-(4-methylphenyl)sulfonyl-2-phenylpyrrole-3-carboxylate (PubChem CID 51359206) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is ethyl 1-(4-methylphenyl)sulfonyl-2-phenylpyrrole-3-carboxylate.
| Compound Name | ethyl 1-(4-methylphenyl)sulfonyl-2-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 51359206 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | ethyl 1-(4-methylphenyl)sulfonyl-2-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1ccn(S(=O)(=O)c2ccc(C)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C20H19NO4S/c1-3-25-20(22)18-13-14-21(19(18)16-7-5-4-6-8-16)26(23,24)17-11-9-15(2)10-12-17/h4-14H,3H2,1-2H3 |
| InChIKey | MVPSRLYXVKSWNR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |