C21H27NO4S — CID 174568433
1-(4-tert-butylphenyl)sulfonyl-2,3-dihydroindole;ethyl formate (PubChem CID 174568433) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-2,3-dihydroindole;ethyl formate.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-2,3-dihydroindole;ethyl formate |
|---|---|
| PubChem CID | 174568433 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-2,3-dihydroindole;ethyl formate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCc3ccccc32)cc1.CCOC=O |
| InChI | InChI=1S/C18H21NO2S.C3H6O2/c1-18(2,3)15-8-10-16(11-9-15)22(20,21)19-13-12-14-6-4-5-7-17(14)19;1-2-5-3-4/h4-11H,12-13H2,1-3H3;3H,2H2,1H3 |
| InChIKey | SIGKCRBXTQUXMO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|