C17H15FN2 — CID 174570438
8-(3-fluorophenyl)-6-propyl-1,7-naphthyridine (PubChem CID 174570438) has the molecular formula C17H15FN2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 8-(3-fluorophenyl)-6-propyl-1,7-naphthyridine.
| Compound Name | 8-(3-fluorophenyl)-6-propyl-1,7-naphthyridine |
|---|---|
| PubChem CID | 174570438 |
| Molecular Formula | C17H15FN2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 8-(3-fluorophenyl)-6-propyl-1,7-naphthyridine |
| SMILES | CCCc1cc2cccnc2c(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C17H15FN2/c1-2-5-15-11-13-7-4-9-19-16(13)17(20-15)12-6-3-8-14(18)10-12/h3-4,6-11H,2,5H2,1H3 |
| InChIKey | ABIAZHDJAICSCW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |