C20H23FN4 — CID 143600390
N-ethyl-N'-[8-(3-fluorophenyl)-1,7-naphthyridin-6-yl]butane-1,4-diamine (PubChem CID 143600390) has the molecular formula C20H23FN4 and a molecular weight of 338.43 g/mol. Its IUPAC name is N-ethyl-N'-[8-(3-fluorophenyl)-1,7-naphthyridin-6-yl]butane-1,4-diamine.
| Compound Name | N-ethyl-N'-[8-(3-fluorophenyl)-1,7-naphthyridin-6-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 143600390 |
| Molecular Formula | C20H23FN4 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | N-ethyl-N'-[8-(3-fluorophenyl)-1,7-naphthyridin-6-yl]butane-1,4-diamine |
| SMILES | CCNCCCCNc1cc2cccnc2c(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C20H23FN4/c1-2-22-10-3-4-11-23-18-14-16-8-6-12-24-19(16)20(25-18)15-7-5-9-17(21)13-15/h5-9,12-14,22H,2-4,10-11H2,1H3,(H,23,25) |
| InChIKey | HADWBHGKQLUJTI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|