C15H20N4OS — CID 17457094
N-(1-cyanocyclohexyl)-2-(1-cyclopropylimidazol-2-yl)sulfanylacetamide (PubChem CID 17457094) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-(1-cyclopropylimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-(1-cyclopropylimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 17457094 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-(1-cyclopropylimidazol-2-yl)sulfanylacetamide |
| SMILES | N#CC1(NC(=O)CSc2nccn2C2CC2)CCCCC1 |
| InChI | InChI=1S/C15H20N4OS/c16-11-15(6-2-1-3-7-15)18-13(20)10-21-14-17-8-9-19(14)12-4-5-12/h8-9,12H,1-7,10H2,(H,18,20) |
| InChIKey | VUCMRPUWUMDGSZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |