C6H17KNO5P — CID 174571533
potassium;[4-(dimethylamino)-3-hydroxybutyl] dihydrogen phosphate;hydride (PubChem CID 174571533) has the molecular formula C6H17KNO5P and a molecular weight of 253.28 g/mol. Its IUPAC name is potassium;[4-(dimethylamino)-3-hydroxybutyl] dihydrogen phosphate;hydride.
| Compound Name | potassium;[4-(dimethylamino)-3-hydroxybutyl] dihydrogen phosphate;hydride |
|---|---|
| PubChem CID | 174571533 |
| Molecular Formula | C6H17KNO5P |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | potassium;[4-(dimethylamino)-3-hydroxybutyl] dihydrogen phosphate;hydride |
| SMILES | CN(C)CC(O)CCOP(=O)(O)O.[H-].[K+] |
| InChI | InChI=1S/C6H16NO5P.K.H/c1-7(2)5-6(8)3-4-12-13(9,10)11;;/h6,8H,3-5H2,1-2H3,(H2,9,10,11);;/q;+1;-1 |
| InChIKey | CFWLEWAVOZMMNI-UHFFFAOYSA-N |
| XLogP | -3.48 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|