C3H10NaO6P — CID 174223594
sodium;3,3-dihydroxypropyl dihydrogen phosphate;hydride (PubChem CID 174223594) has the molecular formula C3H10NaO6P and a molecular weight of 196.07 g/mol. Its IUPAC name is sodium;3,3-dihydroxypropyl dihydrogen phosphate;hydride.
| Compound Name | sodium;3,3-dihydroxypropyl dihydrogen phosphate;hydride |
|---|---|
| PubChem CID | 174223594 |
| Molecular Formula | C3H10NaO6P |
| Molecular Weight | 196.07 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | sodium;3,3-dihydroxypropyl dihydrogen phosphate;hydride |
| SMILES | O=P(O)(O)OCCC(O)O.[H-].[Na+] |
| InChI | InChI=1S/C3H9O6P.Na.H/c4-3(5)1-2-9-10(6,7)8;;/h3-5H,1-2H2,(H2,6,7,8);;/q;+1;-1 |
| InChIKey | KWDFAPZNNSXLDD-UHFFFAOYSA-N |
| XLogP | -4.09 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.07 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|