C8H15O7P — CID 87186844
3-(2-hydroxyethyl)-2-methylidene-5-phosphonooxypentanoic acid (PubChem CID 87186844) has the molecular formula C8H15O7P and a molecular weight of 254.17 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-2-methylidene-5-phosphonooxypentanoic acid.
| Compound Name | 3-(2-hydroxyethyl)-2-methylidene-5-phosphonooxypentanoic acid |
|---|---|
| PubChem CID | 87186844 |
| Molecular Formula | C8H15O7P |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3-(2-hydroxyethyl)-2-methylidene-5-phosphonooxypentanoic acid |
| SMILES | C=C(C(=O)O)C(CCO)CCOP(=O)(O)O |
| InChI | InChI=1S/C8H15O7P/c1-6(8(10)11)7(2-4-9)3-5-15-16(12,13)14/h7,9H,1-5H2,(H,10,11)(H2,12,13,14) |
| InChIKey | YANRKJVIEUWEAO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|