C11H13ClF2O2 — CID 174571808
tert-butyl formate;2-chloro-1,3-difluorobenzene (PubChem CID 174571808) has the molecular formula C11H13ClF2O2 and a molecular weight of 250.67 g/mol. Its IUPAC name is tert-butyl formate;2-chloro-1,3-difluorobenzene.
| Compound Name | tert-butyl formate;2-chloro-1,3-difluorobenzene |
|---|---|
| PubChem CID | 174571808 |
| Molecular Formula | C11H13ClF2O2 |
| Molecular Weight | 250.67 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | tert-butyl formate;2-chloro-1,3-difluorobenzene |
| SMILES | CC(C)(C)OC=O.Fc1cccc(F)c1Cl |
| InChI | InChI=1S/C6H3ClF2.C5H10O2/c7-6-4(8)2-1-3-5(6)9;1-5(2,3)7-4-6/h1-3H;4H,1-3H3 |
| InChIKey | OHNVYPRADMPHQR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.67 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|