About tellane;trimethyl(trimethylsilyl)silane
tellane;trimethyl(trimethylsilyl)silane (PubChem CID 174572785) has the molecular formula C6H20Si2Te
and a molecular weight of 276.00 g/mol. Its IUPAC name is tellane;trimethyl(trimethylsilyl)silane.
Molecular Properties
| Compound Name | tellane;trimethyl(trimethylsilyl)silane |
| PubChem CID | 174572785 |
| Molecular Formula | C6H20Si2Te |
| Molecular Weight | 276.00 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | tellane;trimethyl(trimethylsilyl)silane |
| SMILES | C[Si](C)(C)[Si](C)(C)C.[TeH2] |
| InChI | InChI=1S/C6H18Si2.H2Te/c1-7(2,3)8(4,5)6;/h1-6H3;1H2 |
| InChIKey | AZVZOGZQEYEKLT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.00 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tellane;trimethyl(trimethylsilyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tellane;trimethyl(trimethylsilyl)silane?
The IUPAC name of tellane;trimethyl(trimethylsilyl)silane (CID 174572785) is tellane;trimethyl(trimethylsilyl)silane.
What is the SMILES notation for tellane;trimethyl(trimethylsilyl)silane?
The canonical SMILES for tellane;trimethyl(trimethylsilyl)silane is C[Si](C)(C)[Si](C)(C)C.[TeH2].
What is the InChIKey of tellane;trimethyl(trimethylsilyl)silane?
The InChIKey is AZVZOGZQEYEKLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18Si2.H2Te/c1-7(2,3)8(4,5)6;/h1-6H3;1H2.
What are the key properties of tellane;trimethyl(trimethylsilyl)silane?
tellane;trimethyl(trimethylsilyl)silane has a molecular weight of 276.00 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tellane;trimethyl(trimethylsilyl)silane is sourced from PubChem (CID 174572785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).