C8H13RuSi — CID 174573156
cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+) (PubChem CID 174573156) has the molecular formula C8H13RuSi and a molecular weight of 238.35 g/mol. Its IUPAC name is cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+).
| Compound Name | cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+) |
|---|---|
| PubChem CID | 174573156 |
| Molecular Formula | C8H13RuSi |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+) |
| SMILES | C[Si](C)(C)C1=[C-]CC=C1.[Ru+] |
| InChI | InChI=1S/C8H13Si.Ru/c1-9(2,3)8-6-4-5-7-8;/h4,6H,5H2,1-3H3;/q-1;+1 |
| InChIKey | XNLYLDRGPMXBIS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|