About cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+)
cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+) (PubChem CID 174573156) has the molecular formula C8H13RuSi
and a molecular weight of 238.35 g/mol. Its IUPAC name is cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+).
Molecular Properties
| Compound Name | cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+) |
| PubChem CID | 174573156 |
| Molecular Formula | C8H13RuSi |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+) |
| SMILES | C[Si](C)(C)C1=[C-]CC=C1.[Ru+] |
| InChI | InChI=1S/C8H13Si.Ru/c1-9(2,3)8-6-4-5-7-8;/h4,6H,5H2,1-3H3;/q-1;+1 |
| InChIKey | XNLYLDRGPMXBIS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+)?
The IUPAC name of cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+) (CID 174573156) is cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+).
What is the SMILES notation for cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+)?
The canonical SMILES for cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+) is C[Si](C)(C)C1=[C-]CC=C1.[Ru+].
What is the InChIKey of cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+)?
The InChIKey is XNLYLDRGPMXBIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Si.Ru/c1-9(2,3)8-6-4-5-7-8;/h4,6H,5H2,1-3H3;/q-1;+1.
What are the key properties of cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+)?
cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+) has a molecular weight of 238.35 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,4-dien-1-yl(trimethyl)silane;ruthenium(1+) is sourced from PubChem (CID 174573156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).