C29H37Si2Zr — CID 174985853
bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);phenylmethylbenzene;zirconium(3+) (PubChem CID 174985853) has the molecular formula C29H37Si2Zr and a molecular weight of 533.01 g/mol. Its IUPAC name is bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);phenylmethylbenzene;zirconium(3+).
| Compound Name | bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);phenylmethylbenzene;zirconium(3+) |
|---|---|
| PubChem CID | 174985853 |
| Molecular Formula | C29H37Si2Zr |
| Molecular Weight | 533.01 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | bis(cyclopenta-1,4-dien-1-yl(trimethyl)silane);phenylmethylbenzene;zirconium(3+) |
| SMILES | C[Si](C)(C)C1=[C-]CC=C1.C[Si](C)(C)C1=[C-]CC=C1.[Zr+3].c1ccc([CH-]c2ccccc2)cc1 |
| InChI | InChI=1S/C13H11.2C8H13Si.Zr/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2*1-9(2,3)8-6-4-5-7-8;/h1-11H;2*4,6H,5H2,1-3H3;/q3*-1;+3 |
| InChIKey | AAJCYNDONWKHRN-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.01 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|