C13H21O3PS — CID 174576787
hexoxy-hydroxy-(4-methylphenoxy)-sulfanylidene-λ5-phosphane (PubChem CID 174576787) has the molecular formula C13H21O3PS and a molecular weight of 288.35 g/mol. Its IUPAC name is hexoxy-hydroxy-(4-methylphenoxy)-sulfanylidene-λ5-phosphane.
| Compound Name | hexoxy-hydroxy-(4-methylphenoxy)-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 174576787 |
| Molecular Formula | C13H21O3PS |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | hexoxy-hydroxy-(4-methylphenoxy)-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCCOP(O)(=S)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C13H21O3PS/c1-3-4-5-6-11-15-17(14,18)16-13-9-7-12(2)8-10-13/h7-10H,3-6,11H2,1-2H3,(H,14,18) |
| InChIKey | NEYPBWOUYBZNJK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|