C24H21F4N3O3S — CID 174576947
N-[amino-(3-methyl-4-methylsulfonylphenyl)methyl]-3-[2-(3-fluorophenyl)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide (PubChem CID 174576947) has the molecular formula C24H21F4N3O3S and a molecular weight of 507.51 g/mol. Its IUPAC name is N-[amino-(3-methyl-4-methylsulfonylphenyl)methyl]-3-[2-(3-fluorophenyl)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[amino-(3-methyl-4-methylsulfonylphenyl)methyl]-3-[2-(3-fluorophenyl)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 174576947 |
| Molecular Formula | C24H21F4N3O3S |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | N-[amino-(3-methyl-4-methylsulfonylphenyl)methyl]-3-[2-(3-fluorophenyl)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
| SMILES | Cc1cc(C(N)NC(=O)C=Cc2ccc(C(F)(F)F)nc2-c2cccc(F)c2)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C24H21F4N3O3S/c1-14-12-17(6-9-19(14)35(2,33)34)23(29)31-21(32)11-8-15-7-10-20(24(26,27)28)30-22(15)16-4-3-5-18(25)13-16/h3-13,23H,29H2,1-2H3,(H,31,32) |
| InChIKey | NHGXMAZFPWARAB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|