C22H24N4O3S — CID 174577956
2-(carbamoylamino)-5-[4-[(2R)-4-(hydroxyamino)-2-phenylbutyl]phenyl]thiophene-3-carboxamide (PubChem CID 174577956) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-[4-[(2R)-4-(hydroxyamino)-2-phenylbutyl]phenyl]thiophene-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-[4-[(2R)-4-(hydroxyamino)-2-phenylbutyl]phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 174577956 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-(carbamoylamino)-5-[4-[(2R)-4-(hydroxyamino)-2-phenylbutyl]phenyl]thiophene-3-carboxamide |
| SMILES | NC(=O)Nc1sc(-c2ccc(C[C@H](CCNO)c3ccccc3)cc2)cc1C(N)=O |
| InChI | InChI=1S/C22H24N4O3S/c23-20(27)18-13-19(30-21(18)26-22(24)28)16-8-6-14(7-9-16)12-17(10-11-25-29)15-4-2-1-3-5-15/h1-9,13,17,25,29H,10-12H2,(H2,23,27)(H3,24,26,28)/t17-/m0/s1 |
| InChIKey | IPYIAWRYJNYREL-KRWDZBQOSA-N |
| XLogP | 3.70 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|