C12H13F3N2O4S — CID 174578545
5-[2-hydroxy-4-(3,3,3-trifluoropropyl)phenyl]-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde (PubChem CID 174578545) has the molecular formula C12H13F3N2O4S and a molecular weight of 338.31 g/mol. Its IUPAC name is 5-[2-hydroxy-4-(3,3,3-trifluoropropyl)phenyl]-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde.
| Compound Name | 5-[2-hydroxy-4-(3,3,3-trifluoropropyl)phenyl]-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 174578545 |
| Molecular Formula | C12H13F3N2O4S |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 5-[2-hydroxy-4-(3,3,3-trifluoropropyl)phenyl]-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde |
| SMILES | O=CC1CN(c2ccc(CCC(F)(F)F)cc2O)S(=O)(=O)N1 |
| InChI | InChI=1S/C12H13F3N2O4S/c13-12(14,15)4-3-8-1-2-10(11(19)5-8)17-6-9(7-18)16-22(17,20)21/h1-2,5,7,9,16,19H,3-4,6H2 |
| InChIKey | SVNFAWCPOSGWNF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|