C12H24N2OSi — CID 174581390
1-(2-tert-butyl-1H-imidazol-5-yl)-1-trimethylsilylethanol (PubChem CID 174581390) has the molecular formula C12H24N2OSi and a molecular weight of 240.42 g/mol. Its IUPAC name is 1-(2-tert-butyl-1H-imidazol-5-yl)-1-trimethylsilylethanol.
| Compound Name | 1-(2-tert-butyl-1H-imidazol-5-yl)-1-trimethylsilylethanol |
|---|---|
| PubChem CID | 174581390 |
| Molecular Formula | C12H24N2OSi |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1-(2-tert-butyl-1H-imidazol-5-yl)-1-trimethylsilylethanol |
| SMILES | CC(C)(C)c1ncc(C(C)(O)[Si](C)(C)C)[nH]1 |
| InChI | InChI=1S/C12H24N2OSi/c1-11(2,3)10-13-8-9(14-10)12(4,15)16(5,6)7/h8,15H,1-7H3,(H,13,14) |
| InChIKey | KQSUGUKAMSYWHL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|