C14H26N2 — CID 140580734
2-(2-methylbutan-2-yl)-5-(3-methylpentan-3-yl)-1H-imidazole (PubChem CID 140580734) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 2-(2-methylbutan-2-yl)-5-(3-methylpentan-3-yl)-1H-imidazole.
| Compound Name | 2-(2-methylbutan-2-yl)-5-(3-methylpentan-3-yl)-1H-imidazole |
|---|---|
| PubChem CID | 140580734 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 2-(2-methylbutan-2-yl)-5-(3-methylpentan-3-yl)-1H-imidazole |
| SMILES | CCC(C)(C)c1ncc(C(C)(CC)CC)[nH]1 |
| InChI | InChI=1S/C14H26N2/c1-7-13(4,5)12-15-10-11(16-12)14(6,8-2)9-3/h10H,7-9H2,1-6H3,(H,15,16) |
| InChIKey | PYHYIOBSLYNJBS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |