C15H24N2 — CID 126513989
2-ethynyl-5-(3-methylnonan-3-yl)-1H-imidazole (PubChem CID 126513989) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-ethynyl-5-(3-methylnonan-3-yl)-1H-imidazole.
| Compound Name | 2-ethynyl-5-(3-methylnonan-3-yl)-1H-imidazole |
|---|---|
| PubChem CID | 126513989 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2-ethynyl-5-(3-methylnonan-3-yl)-1H-imidazole |
| SMILES | C#Cc1ncc(C(C)(CC)CCCCCC)[nH]1 |
| InChI | InChI=1S/C15H24N2/c1-5-8-9-10-11-15(4,7-3)13-12-16-14(6-2)17-13/h2,12H,5,7-11H2,1,3-4H3,(H,16,17) |
| InChIKey | OSZBPVPTRVEQMR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|