C13H20N2 — CID 129132503
2-ethynyl-5-(2-methylheptan-2-yl)-1H-imidazole (PubChem CID 129132503) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 2-ethynyl-5-(2-methylheptan-2-yl)-1H-imidazole.
| Compound Name | 2-ethynyl-5-(2-methylheptan-2-yl)-1H-imidazole |
|---|---|
| PubChem CID | 129132503 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2-ethynyl-5-(2-methylheptan-2-yl)-1H-imidazole |
| SMILES | C#Cc1ncc(C(C)(C)CCCCC)[nH]1 |
| InChI | InChI=1S/C13H20N2/c1-5-7-8-9-13(3,4)11-10-14-12(6-2)15-11/h2,10H,5,7-9H2,1,3-4H3,(H,14,15) |
| InChIKey | SJZWYLGHWDMFKN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|