C20H34N2 — CID 129028311
5-ethynyl-4-(7-methyltetradecan-7-yl)-1H-pyrazole (PubChem CID 129028311) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 5-ethynyl-4-(7-methyltetradecan-7-yl)-1H-pyrazole.
| Compound Name | 5-ethynyl-4-(7-methyltetradecan-7-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 129028311 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 5-ethynyl-4-(7-methyltetradecan-7-yl)-1H-pyrazole |
| SMILES | C#Cc1[nH]ncc1C(C)(CCCCCC)CCCCCCC |
| InChI | InChI=1S/C20H34N2/c1-5-8-10-12-14-16-20(4,15-13-11-9-6-2)18-17-21-22-19(18)7-3/h3,17H,5-6,8-16H2,1-2,4H3,(H,21,22) |
| InChIKey | WMWPSLLERQYVKL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|