C14H15ClN2O4 — CID 174581600
benzene-1,3-dicarboxylic acid;N-methylpyridin-3-amine;hydrochloride (PubChem CID 174581600) has the molecular formula C14H15ClN2O4 and a molecular weight of 310.74 g/mol. Its IUPAC name is benzene-1,3-dicarboxylic acid;N-methylpyridin-3-amine;hydrochloride.
| Compound Name | benzene-1,3-dicarboxylic acid;N-methylpyridin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 174581600 |
| Molecular Formula | C14H15ClN2O4 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | benzene-1,3-dicarboxylic acid;N-methylpyridin-3-amine;hydrochloride |
| SMILES | CNc1cccnc1.Cl.O=C(O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H6O4.C6H8N2.ClH/c9-7(10)5-2-1-3-6(4-5)8(11)12;1-7-6-3-2-4-8-5-6;/h1-4H,(H,9,10)(H,11,12);2-5,7H,1H3;1H |
| InChIKey | JBJYKYWWQWGUEA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |