C20H34N4O4 — CID 174583392
bis(1,5-diamino-2-methylpentyl) benzene-1,4-dicarboxylate (PubChem CID 174583392) has the molecular formula C20H34N4O4 and a molecular weight of 394.52 g/mol. Its IUPAC name is bis(1,5-diamino-2-methylpentyl) benzene-1,4-dicarboxylate.
| Compound Name | bis(1,5-diamino-2-methylpentyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 174583392 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | bis(1,5-diamino-2-methylpentyl) benzene-1,4-dicarboxylate |
| SMILES | CC(CCCN)C(N)OC(=O)c1ccc(C(=O)OC(N)C(C)CCCN)cc1 |
| InChI | InChI=1S/C20H34N4O4/c1-13(5-3-11-21)17(23)27-19(25)15-7-9-16(10-8-15)20(26)28-18(24)14(2)6-4-12-22/h7-10,13-14,17-18H,3-6,11-12,21-24H2,1-2H3 |
| InChIKey | ODILLQIHVQJFQR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 156.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|