C22H31N3O6 — CID 174583493
(2S)-2-[[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylpentanoic acid (PubChem CID 174583493) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is (2S)-2-[[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 174583493 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | (2S)-2-[[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](C(=O)O)N(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31N3O6/c1-13(2)10-18(20(28)29)25(21(30)31-22(3,4)5)24-17(19(26)27)11-14-12-23-16-9-7-6-8-15(14)16/h6-9,12-13,17-18,23-24H,10-11H2,1-5H3,(H,26,27)(H,28,29)/t17-,18-/m0/s1 |
| InChIKey | UHVHMPQBQNXSBI-ROUUACIJSA-N |
| XLogP | 3.40 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|