About (2-aminoethylamino) acetate;hydrochloride
(2-aminoethylamino) acetate;hydrochloride (PubChem CID 174583759) has the molecular formula C4H11ClN2O2
and a molecular weight of 154.60 g/mol. Its IUPAC name is (2-aminoethylamino) acetate;hydrochloride.
Molecular Properties
| Compound Name | (2-aminoethylamino) acetate;hydrochloride |
| PubChem CID | 174583759 |
| Molecular Formula | C4H11ClN2O2 |
| Molecular Weight | 154.60 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | (2-aminoethylamino) acetate;hydrochloride |
| SMILES | CC(=O)ONCCN.Cl |
| InChI | InChI=1S/C4H10N2O2.ClH/c1-4(7)8-6-3-2-5;/h6H,2-3,5H2,1H3;1H |
| InChIKey | HOZOBOLNRNHSRY-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.60 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-aminoethylamino) acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminoethylamino) acetate;hydrochloride?
The IUPAC name of (2-aminoethylamino) acetate;hydrochloride (CID 174583759) is (2-aminoethylamino) acetate;hydrochloride.
What is the SMILES notation for (2-aminoethylamino) acetate;hydrochloride?
The canonical SMILES for (2-aminoethylamino) acetate;hydrochloride is CC(=O)ONCCN.Cl.
What is the InChIKey of (2-aminoethylamino) acetate;hydrochloride?
The InChIKey is HOZOBOLNRNHSRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2.ClH/c1-4(7)8-6-3-2-5;/h6H,2-3,5H2,1H3;1H.
What are the key properties of (2-aminoethylamino) acetate;hydrochloride?
(2-aminoethylamino) acetate;hydrochloride has a molecular weight of 154.60 g/mol, XLogP of -0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminoethylamino) acetate;hydrochloride is sourced from PubChem (CID 174583759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).