About (2-aminoethylamino) N-aminocarbamate
(2-aminoethylamino) N-aminocarbamate (PubChem CID 174871175) has the molecular formula C3H10N4O2
and a molecular weight of 134.14 g/mol. Its IUPAC name is (2-aminoethylamino) N-aminocarbamate.
Molecular Properties
| Compound Name | (2-aminoethylamino) N-aminocarbamate |
| PubChem CID | 174871175 |
| Molecular Formula | C3H10N4O2 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (2-aminoethylamino) N-aminocarbamate |
| SMILES | NCCNOC(=O)NN |
| InChI | InChI=1S/C3H10N4O2/c4-1-2-6-9-3(8)7-5/h6H,1-2,4-5H2,(H,7,8) |
| InChIKey | SKISYCQPARUIPO-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-aminoethylamino) N-aminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminoethylamino) N-aminocarbamate?
The IUPAC name of (2-aminoethylamino) N-aminocarbamate (CID 174871175) is (2-aminoethylamino) N-aminocarbamate.
What is the SMILES notation for (2-aminoethylamino) N-aminocarbamate?
The canonical SMILES for (2-aminoethylamino) N-aminocarbamate is NCCNOC(=O)NN.
What is the InChIKey of (2-aminoethylamino) N-aminocarbamate?
The InChIKey is SKISYCQPARUIPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N4O2/c4-1-2-6-9-3(8)7-5/h6H,1-2,4-5H2,(H,7,8).
What are the key properties of (2-aminoethylamino) N-aminocarbamate?
(2-aminoethylamino) N-aminocarbamate has a molecular weight of 134.14 g/mol, XLogP of -1.95, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminoethylamino) N-aminocarbamate is sourced from PubChem (CID 174871175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).