C27H35NO3 — CID 174584161
methyl (8S,9S,10R,13S,14S,17S)-4-(1H-azepin-2-yl)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 174584161) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is methyl (8S,9S,10R,13S,14S,17S)-4-(1H-azepin-2-yl)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | methyl (8S,9S,10R,13S,14S,17S)-4-(1H-azepin-2-yl)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 174584161 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | methyl (8S,9S,10R,13S,14S,17S)-4-(1H-azepin-2-yl)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | COC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4C(C5=CC=CC=CN5)C(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H35NO3/c1-26-15-13-23(29)24(22-7-5-4-6-16-28-22)20(26)9-8-17-18-10-11-21(25(30)31-3)27(18,2)14-12-19(17)26/h4-7,9,16-19,21,24,28H,8,10-15H2,1-3H3/t17-,18-,19-,21+,24?,26+,27-/m0/s1 |
| InChIKey | CGHYBQLQZPPECL-XGEZQROFSA-N |
| XLogP | 5.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|