C19H22ClFN4O2 — CID 174584166
3-[4-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)piperazin-1-yl]-2-(4-fluorophenyl)propanal (PubChem CID 174584166) has the molecular formula C19H22ClFN4O2 and a molecular weight of 392.86 g/mol. Its IUPAC name is 3-[4-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)piperazin-1-yl]-2-(4-fluorophenyl)propanal.
| Compound Name | 3-[4-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)piperazin-1-yl]-2-(4-fluorophenyl)propanal |
|---|---|
| PubChem CID | 174584166 |
| Molecular Formula | C19H22ClFN4O2 |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3-[4-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)piperazin-1-yl]-2-(4-fluorophenyl)propanal |
| SMILES | Cc1c(Cl)c(C(=O)N2CCN(CC(C=O)c3ccc(F)cc3)CC2)nn1C |
| InChI | InChI=1S/C19H22ClFN4O2/c1-13-17(20)18(22-23(13)2)19(27)25-9-7-24(8-10-25)11-15(12-26)14-3-5-16(21)6-4-14/h3-6,12,15H,7-11H2,1-2H3 |
| InChIKey | ISIPDQGAJPKXAR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|