C20H20N2O2 — CID 174584723
3-(2-imino-1-phenylpentan-3-yl)-1H-indole-6-carboxylic acid (PubChem CID 174584723) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-(2-imino-1-phenylpentan-3-yl)-1H-indole-6-carboxylic acid.
| Compound Name | 3-(2-imino-1-phenylpentan-3-yl)-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 174584723 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3-(2-imino-1-phenylpentan-3-yl)-1H-indole-6-carboxylic acid |
| SMILES | [H]/N=C(\Cc1ccccc1)C(CC)c1c[nH]c2cc(C(=O)O)ccc12 |
| InChI | InChI=1S/C20H20N2O2/c1-2-15(18(21)10-13-6-4-3-5-7-13)17-12-22-19-11-14(20(23)24)8-9-16(17)19/h3-9,11-12,15,21-22H,2,10H2,1H3,(H,23,24)/b21-18+ |
| InChIKey | XLWSBSYOMLDYDU-DYTRJAOYSA-N |
| XLogP | 4.62 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|