C19H27NO3 — CID 174584805
(5-benzyl-2-ethyl-4-oxopiperidin-1-yl) 2,2-dimethylpropanoate (PubChem CID 174584805) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (5-benzyl-2-ethyl-4-oxopiperidin-1-yl) 2,2-dimethylpropanoate.
| Compound Name | (5-benzyl-2-ethyl-4-oxopiperidin-1-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174584805 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (5-benzyl-2-ethyl-4-oxopiperidin-1-yl) 2,2-dimethylpropanoate |
| SMILES | CCC1CC(=O)C(Cc2ccccc2)CN1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H27NO3/c1-5-16-12-17(21)15(11-14-9-7-6-8-10-14)13-20(16)23-18(22)19(2,3)4/h6-10,15-16H,5,11-13H2,1-4H3 |
| InChIKey | DHBRPLBKFGJGAJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |