C18H27NO2 — CID 175316100
(4-benzyl-2-methylpiperidin-1-yl) 2,2-dimethylpropanoate (PubChem CID 175316100) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (4-benzyl-2-methylpiperidin-1-yl) 2,2-dimethylpropanoate.
| Compound Name | (4-benzyl-2-methylpiperidin-1-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175316100 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (4-benzyl-2-methylpiperidin-1-yl) 2,2-dimethylpropanoate |
| SMILES | CC1CC(Cc2ccccc2)CCN1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H27NO2/c1-14-12-16(13-15-8-6-5-7-9-15)10-11-19(14)21-17(20)18(2,3)4/h5-9,14,16H,10-13H2,1-4H3 |
| InChIKey | MJNDXDQFXNDKEM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |