C10H14FN5O4 — CID 174585334
(2R,3R,4S,5R)-2-(6-amino-7-fluoro-8H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 174585334) has the molecular formula C10H14FN5O4 and a molecular weight of 287.25 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-7-fluoro-8H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-7-fluoro-8H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 174585334 |
| Molecular Formula | C10H14FN5O4 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-7-fluoro-8H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1N(F)CN2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H14FN5O4/c11-16-3-15(9-5(16)8(12)13-2-14-9)10-7(19)6(18)4(1-17)20-10/h2,4,6-7,10,17-19H,1,3H2,(H2,12,13,14)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | GAQABWBHFWXDMZ-KQYNXXCUSA-N |
| XLogP | -2.03 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|