C17H29N5O6 — CID 134249684
(2R,3R,4S,5R)-2-[6-amino-7-(1,2-dihydroxyheptyl)-8H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 134249684) has the molecular formula C17H29N5O6 and a molecular weight of 399.45 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-7-(1,2-dihydroxyheptyl)-8H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-7-(1,2-dihydroxyheptyl)-8H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 134249684 |
| Molecular Formula | C17H29N5O6 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-7-(1,2-dihydroxyheptyl)-8H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCCCCC(O)C(O)N1CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c2ncnc(N)c21 |
| InChI | InChI=1S/C17H29N5O6/c1-2-3-4-5-9(24)16(27)21-8-22(15-11(21)14(18)19-7-20-15)17-13(26)12(25)10(6-23)28-17/h7,9-10,12-13,16-17,23-27H,2-6,8H2,1H3,(H2,18,19,20)/t9?,10-,12-,13-,16?,17-/m1/s1 |
| InChIKey | MXLXFKJCGJRIGO-OQFHTMRQSA-N |
| XLogP | -1.66 |
| TPSA | 168.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|