C17H32N8O3 — CID 70501830
(2R,5R)-2-[6-amino-7-(1,7-diaminoheptan-3-ylamino)-8H-purin-9-yl]-5-methyloxolane-3,4-diol (PubChem CID 70501830) has the molecular formula C17H32N8O3 and a molecular weight of 396.50 g/mol. Its IUPAC name is (2R,5R)-2-[6-amino-7-(1,7-diaminoheptan-3-ylamino)-8H-purin-9-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,5R)-2-[6-amino-7-(1,7-diaminoheptan-3-ylamino)-8H-purin-9-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 70501830 |
| Molecular Formula | C17H32N8O3 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | (2R,5R)-2-[6-amino-7-(1,7-diaminoheptan-3-ylamino)-8H-purin-9-yl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](N2CN(NC(CCN)CCCCN)c3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C17H32N8O3/c1-10-13(26)14(27)17(28-10)24-9-25(12-15(20)21-8-22-16(12)24)23-11(5-7-19)4-2-3-6-18/h8,10-11,13-14,17,23,26-27H,2-7,9,18-19H2,1H3,(H2,20,21,22)/t10-,11?,13?,14?,17-/m1/s1 |
| InChIKey | YWMXZMCTXLAUIF-OXLCNYKFSA-N |
| XLogP | -1.54 |
| TPSA | 172.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|