C21H40N8O3 — CID 70500696
(2R,5R)-2-[6-amino-7-(1,11-diaminoundecan-3-ylamino)-8H-purin-9-yl]-5-methyloxolane-3,4-diol (PubChem CID 70500696) has the molecular formula C21H40N8O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is (2R,5R)-2-[6-amino-7-(1,11-diaminoundecan-3-ylamino)-8H-purin-9-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,5R)-2-[6-amino-7-(1,11-diaminoundecan-3-ylamino)-8H-purin-9-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 70500696 |
| Molecular Formula | C21H40N8O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | (2R,5R)-2-[6-amino-7-(1,11-diaminoundecan-3-ylamino)-8H-purin-9-yl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](N2CN(NC(CCN)CCCCCCCCN)c3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C21H40N8O3/c1-14-17(30)18(31)21(32-14)28-13-29(16-19(24)25-12-26-20(16)28)27-15(9-11-23)8-6-4-2-3-5-7-10-22/h12,14-15,17-18,21,27,30-31H,2-11,13,22-23H2,1H3,(H2,24,25,26)/t14-,15?,17?,18?,21-/m1/s1 |
| InChIKey | VOLQMVDAZRPWDN-VKWHCDNHSA-N |
| XLogP | 0.02 |
| TPSA | 172.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|