C14H28N2 — CID 174586231
1,3-dipentyl-2,4-dihydropyrimidine (PubChem CID 174586231) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 1,3-dipentyl-2,4-dihydropyrimidine.
| Compound Name | 1,3-dipentyl-2,4-dihydropyrimidine |
|---|---|
| PubChem CID | 174586231 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 1,3-dipentyl-2,4-dihydropyrimidine |
| SMILES | CCCCCN1C=CCN(CCCCC)C1 |
| InChI | InChI=1S/C14H28N2/c1-3-5-7-10-15-12-9-13-16(14-15)11-8-6-4-2/h9,12H,3-8,10-11,13-14H2,1-2H3 |
| InChIKey | OOHYKAHVEKQBKZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|