C11H19F3N2S — CID 174586878
CID 174586878 (PubChem CID 174586878) has the molecular formula C11H19F3N2S and a molecular weight of 268.35 g/mol.
| Compound Name | CID 174586878 |
|---|---|
| PubChem CID | 174586878 |
| Molecular Formula | C11H19F3N2S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | — |
| SMILES | CCCCN1C=CC=C(C)C1.FC(F)F.N=S |
| InChI | InChI=1S/C10H17N.CHF3.HNS/c1-3-4-7-11-8-5-6-10(2)9-11;2-1(3)4;1-2/h5-6,8H,3-4,7,9H2,1-2H3;1H;1H |
| InChIKey | UEXKIJKADGLPOR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |