About 1-butyl-2H-pyridine;hydron;tetrafluoroborate
1-butyl-2H-pyridine;hydron;tetrafluoroborate (PubChem CID 174529026) has the molecular formula C9H16BF4N
and a molecular weight of 225.04 g/mol. Its IUPAC name is 1-butyl-2H-pyridine;hydron;tetrafluoroborate.
Molecular Properties
| Compound Name | 1-butyl-2H-pyridine;hydron;tetrafluoroborate |
| PubChem CID | 174529026 |
| Molecular Formula | C9H16BF4N |
| Molecular Weight | 225.04 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-butyl-2H-pyridine;hydron;tetrafluoroborate |
| SMILES | CCCCN1C=CC=CC1.F[B-](F)(F)F.[H+] |
| InChI | InChI=1S/C9H15N.BF4/c1-2-3-7-10-8-5-4-6-9-10;2-1(3,4)5/h4-6,8H,2-3,7,9H2,1H3;/q;-1/p+1 |
| InChIKey | KPELWBWXZLFDOP-UHFFFAOYSA-O |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.04 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2H-pyridine;hydron;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2H-pyridine;hydron;tetrafluoroborate?
The IUPAC name of 1-butyl-2H-pyridine;hydron;tetrafluoroborate (CID 174529026) is 1-butyl-2H-pyridine;hydron;tetrafluoroborate.
What is the SMILES notation for 1-butyl-2H-pyridine;hydron;tetrafluoroborate?
The canonical SMILES for 1-butyl-2H-pyridine;hydron;tetrafluoroborate is CCCCN1C=CC=CC1.F[B-](F)(F)F.[H+].
What is the InChIKey of 1-butyl-2H-pyridine;hydron;tetrafluoroborate?
The InChIKey is KPELWBWXZLFDOP-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H15N.BF4/c1-2-3-7-10-8-5-4-6-9-10;2-1(3,4)5/h4-6,8H,2-3,7,9H2,1H3;/q;-1/p+1.
What are the key properties of 1-butyl-2H-pyridine;hydron;tetrafluoroborate?
1-butyl-2H-pyridine;hydron;tetrafluoroborate has a molecular weight of 225.04 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2H-pyridine;hydron;tetrafluoroborate is sourced from PubChem (CID 174529026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).