C13H15N3O2 — CID 174587076
4-cyclopropyl-3-(3-methoxyphenyl)-1,5-dihydro-1,2,4-triazole-5-carbaldehyde (PubChem CID 174587076) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-cyclopropyl-3-(3-methoxyphenyl)-1,5-dihydro-1,2,4-triazole-5-carbaldehyde.
| Compound Name | 4-cyclopropyl-3-(3-methoxyphenyl)-1,5-dihydro-1,2,4-triazole-5-carbaldehyde |
|---|---|
| PubChem CID | 174587076 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-cyclopropyl-3-(3-methoxyphenyl)-1,5-dihydro-1,2,4-triazole-5-carbaldehyde |
| SMILES | COc1cccc(C2=NNC(C=O)N2C2CC2)c1 |
| InChI | InChI=1S/C13H15N3O2/c1-18-11-4-2-3-9(7-11)13-15-14-12(8-17)16(13)10-5-6-10/h2-4,7-8,10,12,14H,5-6H2,1H3 |
| InChIKey | ZVFHUOJSNMTVHJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|